Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Potassium fluoride dihydrate, 98.5+%, Thermo Scientific Chemicals
CAS: 13455-21-5 Molecular Formula: FH4KO2 Molecular Weight (g/mol): 94.13 MDL Number: MFCD00149929 InChI Key: MZFXHSQFQLKKFD-UHFFFAOYSA-M Synonym: potassium fluoride dihydrate,unii-95r1d12heh,potassium dihydrate fluoride,potassium fluoride dihydrate, 98.5+%,potassium fluoride dihydrate, puratronic,potassium fluoride, dihydrate,potassium fluoride kf , dihydrate,acmc-1byyf,ksc497c4l,potassiumfluoridedihydrate PubChem CID: 23708904 SMILES: O.O.[F-].[K+]
| PubChem CID | 23708904 |
|---|---|
| CAS | 13455-21-5 |
| Molecular Weight (g/mol) | 94.13 |
| MDL Number | MFCD00149929 |
| SMILES | O.O.[F-].[K+] |
| Synonym | potassium fluoride dihydrate,unii-95r1d12heh,potassium dihydrate fluoride,potassium fluoride dihydrate, 98.5+%,potassium fluoride dihydrate, puratronic,potassium fluoride, dihydrate,potassium fluoride kf , dihydrate,acmc-1byyf,ksc497c4l,potassiumfluoridedihydrate |
| InChI Key | MZFXHSQFQLKKFD-UHFFFAOYSA-M |
| Molecular Formula | FH4KO2 |
Sodium chlorate, 99% min
CAS: 7775-09-9 Molecular Formula: ClNaO3 Molecular Weight (g/mol): 106.44 MDL Number: MFCD00003479 InChI Key: YZHUMGUJCQRKBT-UHFFFAOYSA-M Synonym: sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal PubChem CID: 516902 ChEBI: CHEBI:65242 IUPAC Name: sodium chlorate SMILES: [Na+].[O-][Cl](=O)=O
| PubChem CID | 516902 |
|---|---|
| CAS | 7775-09-9 |
| Molecular Weight (g/mol) | 106.44 |
| ChEBI | CHEBI:65242 |
| MDL Number | MFCD00003479 |
| SMILES | [Na+].[O-][Cl](=O)=O |
| Synonym | sodium chlorate,chloric acid, sodium salt,asex,chlorate de sodium,chlorsaure,tumbleleaf,atlacide,desolet,kusatol,rasikal |
| IUPAC Name | sodium chlorate |
| InChI Key | YZHUMGUJCQRKBT-UHFFFAOYSA-M |
| Molecular Formula | ClNaO3 |
Lithium perchlorate, 99+%, for analysis
CAS: 3-9-7791 Molecular Formula: ClLiO4 Molecular Weight (g/mol): 106.39 MDL Number: MFCD00011079 InChI Key: JAWYRNYHJJDXHX-UHFFFAOYSA-M Synonym: lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 PubChem CID: 23665649 IUPAC Name: lithium;perchlorate SMILES: [Li+].[O-]Cl(=O)(=O)=O
| PubChem CID | 23665649 |
|---|---|
| CAS | 3-9-7791 |
| Molecular Weight (g/mol) | 106.39 |
| MDL Number | MFCD00011079 |
| SMILES | [Li+].[O-]Cl(=O)(=O)=O |
| Synonym | lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 |
| IUPAC Name | lithium;perchlorate |
| InChI Key | JAWYRNYHJJDXHX-UHFFFAOYSA-M |
| Molecular Formula | ClLiO4 |
Silver nitrate, 99.85%, for analysis
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
Aluminum acetate, basic hydrate
CAS: 142-03-0 Molecular Formula: C4H7AlO5 Molecular Weight (g/mol): 162.08 MDL Number: MFCD00008688 InChI Key: HQQUTGFAWJNQIP-UHFFFAOYSA-K Synonym: aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate PubChem CID: 18502856 SMILES: CC(=O)O[Al](O)OC(C)=O
| PubChem CID | 18502856 |
|---|---|
| CAS | 142-03-0 |
| Molecular Weight (g/mol) | 162.08 |
| MDL Number | MFCD00008688 |
| SMILES | CC(=O)O[Al](O)OC(C)=O |
| Synonym | aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate |
| InChI Key | HQQUTGFAWJNQIP-UHFFFAOYSA-K |
| Molecular Formula | C4H7AlO5 |
Iron(III) meso-tetraphenylporphine chloride
CAS: 16456-81-8 Molecular Formula: C44H30Cl3FeN4 Molecular Weight (g/mol): 776.947 MDL Number: MFCD00012152 InChI Key: QDTNPIPZGCOFPA-UHFFFAOYSA-K Synonym: 5,10,15,20-tetraphenyl-21h,23h-porphine iron iii chloride,acmc-20am7m,chloro 5,10,15,20-tetraphenyl porphyrinato iron iii,iron iii meso-tetraphenylporphine chloride PubChem CID: 67043998 IUPAC Name: iron(3+);5,10,15,20-tetraphenyl-21,22-dihydroporphyrin;trichloride SMILES: C1=CC=C(C=C1)C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9)N3.[Cl-].[Cl-].[Cl-].[Fe+3]
| PubChem CID | 67043998 |
|---|---|
| CAS | 16456-81-8 |
| Molecular Weight (g/mol) | 776.947 |
| MDL Number | MFCD00012152 |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC(=C(C4=CC=C(N4)C(=C5C=CC(=N5)C(=C6C=CC2=N6)C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC=C9)N3.[Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | 5,10,15,20-tetraphenyl-21h,23h-porphine iron iii chloride,acmc-20am7m,chloro 5,10,15,20-tetraphenyl porphyrinato iron iii,iron iii meso-tetraphenylporphine chloride |
| IUPAC Name | iron(3+);5,10,15,20-tetraphenyl-21,22-dihydroporphyrin;trichloride |
| InChI Key | QDTNPIPZGCOFPA-UHFFFAOYSA-K |
| Molecular Formula | C44H30Cl3FeN4 |
Manganese(II) acetate, 98+%, anhydrous
CAS: 638-38-0 Molecular Formula: C4H6MnO4 Molecular Weight (g/mol): 173.03 MDL Number: MFCD00013039 InChI Key: UOGMEBQRZBEZQT-UHFFFAOYSA-L Synonym: manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y PubChem CID: 12525 IUPAC Name: manganese(2+);diacetate SMILES: [Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 12525 |
|---|---|
| CAS | 638-38-0 |
| Molecular Weight (g/mol) | 173.03 |
| MDL Number | MFCD00013039 |
| SMILES | [Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate,manganese acetate,manganous acetate,diacetylmanganese,manganese diacetate,manganese di acetate,manganese 2+ acetate,octan manganaty czech,acetic acid, manganese 2+ salt,unii-0v6e9q2i0y |
| IUPAC Name | manganese(2+);diacetate |
| InChI Key | UOGMEBQRZBEZQT-UHFFFAOYSA-L |
| Molecular Formula | C4H6MnO4 |
Manganese(II) acetate tetrahydrate, 99+%, for analysis
CAS: 6156-78-1 Molecular Formula: C4H14MnO8 Molecular Weight (g/mol): 245.09 MDL Number: MFCD00062552 InChI Key: CESXSDZNZGSWSP-UHFFFAOYSA-L Synonym: manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp PubChem CID: 93021 SMILES: O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O
| PubChem CID | 93021 |
|---|---|
| CAS | 6156-78-1 |
| Molecular Weight (g/mol) | 245.09 |
| MDL Number | MFCD00062552 |
| SMILES | O.O.O.O.[Mn++].CC([O-])=O.CC([O-])=O |
| Synonym | manganese ii acetate tetrahydrate,manganese acetate tetrahydrate,manganous acetate tetrahydrate,unii-9to51d176n,manganese diacetate, tetrahydrate,manganese 2+ diacetate tetrahydrate,acetic acid, manganese 2+ salt, tetrahydrate,manganese ii acetatetetrahydrate,acmc-20akkp |
| InChI Key | CESXSDZNZGSWSP-UHFFFAOYSA-L |
| Molecular Formula | C4H14MnO8 |
Potassium bromate, ACS, 99.8% min
CAS: 1-2-7758 Molecular Formula: BrKO3 Molecular Weight (g/mol): 167.00 MDL Number: MFCD00011359 InChI Key: OCATYIAKPYKMPG-UHFFFAOYSA-M Synonym: potassium bromate,bromic acid, potassium salt,bromate, potassium,potassium bromate dot,unii-04mb35w6za,ccris 529,eec no. e924,bromic acid, potassium salt 1:1,potassiumbromate,kaliumbromat PubChem CID: 23673461 ChEBI: CHEBI:38211 IUPAC Name: potassium;bromate SMILES: [O-]Br(=O)=O.[K+]
| PubChem CID | 23673461 |
|---|---|
| CAS | 1-2-7758 |
| Molecular Weight (g/mol) | 167.00 |
| ChEBI | CHEBI:38211 |
| MDL Number | MFCD00011359 |
| SMILES | [O-]Br(=O)=O.[K+] |
| Synonym | potassium bromate,bromic acid, potassium salt,bromate, potassium,potassium bromate dot,unii-04mb35w6za,ccris 529,eec no. e924,bromic acid, potassium salt 1:1,potassiumbromate,kaliumbromat |
| IUPAC Name | potassium;bromate |
| InChI Key | OCATYIAKPYKMPG-UHFFFAOYSA-M |
| Molecular Formula | BrKO3 |
Iodine monochloride
CAS: 7790-99-0 Molecular Formula: ClI Molecular Weight (g/mol): 162.35 MDL Number: MFCD00011354 InChI Key: QZRGKCOWNLSUDK-UHFFFAOYSA-N Synonym: iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french PubChem CID: 24640 IUPAC Name: iodochlorane SMILES: ClI
| PubChem CID | 24640 |
|---|---|
| CAS | 7790-99-0 |
| Molecular Weight (g/mol) | 162.35 |
| MDL Number | MFCD00011354 |
| SMILES | ClI |
| Synonym | iodine monochloride,iodine chloride,iodochlorine,iodine chloride icl,chloroiodide,wijs' chloride,iodinemonochloride,chlorine iodide,unii-0smg5nlu45,protochlorure d'iode french |
| IUPAC Name | iodochlorane |
| InChI Key | QZRGKCOWNLSUDK-UHFFFAOYSA-N |
| Molecular Formula | ClI |
Sand, MilliporeSigma™
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: silanedione SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | silanedione |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Ferric Chloride, MP Biomedicals
CAS: 7705-08-0 Molecular Formula: Cl3Fe Molecular Weight (g/mol): 162.20 MDL Number: MFCD00011005 InChI Key: RBTARNINKXHZNM-UHFFFAOYSA-K Synonym: Chlorure Perrique, Iron (III) Chloride, Iron Trichloride, Perchlorure de Fer, Molysite, Ferric chloride IUPAC Name: iron(3+) trichloride SMILES: [Cl-].[Cl-].[Cl-].[Fe+3]
| CAS | 7705-08-0 |
|---|---|
| Molecular Weight (g/mol) | 162.20 |
| MDL Number | MFCD00011005 |
| SMILES | [Cl-].[Cl-].[Cl-].[Fe+3] |
| Synonym | Chlorure Perrique, Iron (III) Chloride, Iron Trichloride, Perchlorure de Fer, Molysite, Ferric chloride |
| IUPAC Name | iron(3+) trichloride |
| InChI Key | RBTARNINKXHZNM-UHFFFAOYSA-K |
| Molecular Formula | Cl3Fe |
Barium pieces, 2.5cm (1in) & down, 99.2% (metals basis), Sr ∣<0.8%
CAS: 7440-39-3 Molecular Formula: Ba Molecular Weight (g/mol): 137.33 MDL Number: MFCD00134031 InChI Key: DSAJWYNOEDNPEQ-UHFFFAOYSA-N Synonym: bario,baryum,bario spanish,baryum french,barium, soluble compounds,unii-24gp945v5t,and soluble compounds,barium, elemental,and compounds,atom PubChem CID: 5355457 ChEBI: CHEBI:32595 IUPAC Name: barium SMILES: [Ba]
| PubChem CID | 5355457 |
|---|---|
| CAS | 7440-39-3 |
| Molecular Weight (g/mol) | 137.33 |
| ChEBI | CHEBI:32595 |
| MDL Number | MFCD00134031 |
| SMILES | [Ba] |
| Synonym | bario,baryum,bario spanish,baryum french,barium, soluble compounds,unii-24gp945v5t,and soluble compounds,barium, elemental,and compounds,atom |
| IUPAC Name | barium |
| InChI Key | DSAJWYNOEDNPEQ-UHFFFAOYSA-N |
| Molecular Formula | Ba |
tert-Butyldiphenylchlorosilane, 97%
CAS: 58479-61-1 Molecular Formula: C16H19ClSi Molecular Weight (g/mol): 274.863 MDL Number: MFCD00000497 InChI Key: MHYGQXWCZAYSLJ-UHFFFAOYSA-N Synonym: tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e PubChem CID: 94078 IUPAC Name: tert-butyl-chloro-diphenylsilane SMILES: CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl
| PubChem CID | 94078 |
|---|---|
| CAS | 58479-61-1 |
| Molecular Weight (g/mol) | 274.863 |
| MDL Number | MFCD00000497 |
| SMILES | CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)Cl |
| Synonym | tert-butylchlorodiphenylsilane,tert-butyldiphenylchlorosilane,t-butyldiphenylchlorosilane,silane, chloro 1,1-dimethylethyl diphenyl,tert-butyl chloro diphenylsilane,t-butylchlorodiphenylsilane,tbdpscl,t-butyldiphenylsilyl chloride,tert-butyldiphenyl chlorosilane,unii-3beu48ui4e |
| IUPAC Name | tert-butyl-chloro-diphenylsilane |
| InChI Key | MHYGQXWCZAYSLJ-UHFFFAOYSA-N |
| Molecular Formula | C16H19ClSi |